C40H42F3N3O4 — CID 59127999
methyl 3-methyl-2-[[2-phenyl-2-[1-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]piperidin-4-yl]acetyl]amino]pentanoate (PubChem CID 59127999) has the molecular formula C40H42F3N3O4 and a molecular weight of 685.79 g/mol. Its IUPAC name is methyl 3-methyl-2-[[2-phenyl-2-[1-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]piperidin-4-yl]acetyl]amino]pentanoate.
| Compound Name | methyl 3-methyl-2-[[2-phenyl-2-[1-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]piperidin-4-yl]acetyl]amino]pentanoate |
|---|---|
| PubChem CID | 59127999 |
| Molecular Formula | C40H42F3N3O4 |
| Molecular Weight | 685.79 g/mol |
| Exact Mass | 685.31 |
| IUPAC Name | methyl 3-methyl-2-[[2-phenyl-2-[1-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]piperidin-4-yl]acetyl]amino]pentanoate |
| SMILES | CCC(C)C(NC(=O)C(c1ccccc1)C1CCN(c2ccc(NC(=O)c3ccccc3-c3ccc(C(F)(F)F)cc3)cc2)CC1)C(=O)OC |
| InChI | InChI=1S/C40H42F3N3O4/c1-4-26(2)36(39(49)50-3)45-38(48)35(28-10-6-5-7-11-28)29-22-24-46(25-23-29)32-20-18-31(19-21-32)44-37(47)34-13-9-8-12-33(34)27-14-16-30(17-15-27)40(41,42)43/h5-21,26,29,35-36H,4,22-25H2,1-3H3,(H,44,47)(H,45,48) |
| InChIKey | QGUMZDZZVAAWDA-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.79 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|