C40H41F3N2O5 — CID 59128011
2-(oxan-2-yloxy)ethyl 2-phenyl-2-[1-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]piperidin-4-yl]acetate (PubChem CID 59128011) has the molecular formula C40H41F3N2O5 and a molecular weight of 686.77 g/mol. Its IUPAC name is 2-(oxan-2-yloxy)ethyl 2-phenyl-2-[1-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]piperidin-4-yl]acetate.
| Compound Name | 2-(oxan-2-yloxy)ethyl 2-phenyl-2-[1-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]piperidin-4-yl]acetate |
|---|---|
| PubChem CID | 59128011 |
| Molecular Formula | C40H41F3N2O5 |
| Molecular Weight | 686.77 g/mol |
| Exact Mass | 686.30 |
| IUPAC Name | 2-(oxan-2-yloxy)ethyl 2-phenyl-2-[1-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]piperidin-4-yl]acetate |
| SMILES | O=C(Nc1ccc(N2CCC(C(C(=O)OCCOC3CCCCO3)c3ccccc3)CC2)cc1)c1ccccc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C40H41F3N2O5/c41-40(42,43)31-15-13-28(14-16-31)34-10-4-5-11-35(34)38(46)44-32-17-19-33(20-18-32)45-23-21-30(22-24-45)37(29-8-2-1-3-9-29)39(47)50-27-26-49-36-12-6-7-25-48-36/h1-5,8-11,13-20,30,36-37H,6-7,12,21-27H2,(H,44,46) |
| InChIKey | METXCPILJCSWHH-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.77 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|