C32H34F3N3O4 — CID 58869909
ethyl 2-[[2-[1-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]piperidin-4-yl]acetyl]amino]propanoate (PubChem CID 58869909) has the molecular formula C32H34F3N3O4 and a molecular weight of 581.64 g/mol. Its IUPAC name is ethyl 2-[[2-[1-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]piperidin-4-yl]acetyl]amino]propanoate.
| Compound Name | ethyl 2-[[2-[1-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]piperidin-4-yl]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 58869909 |
| Molecular Formula | C32H34F3N3O4 |
| Molecular Weight | 581.64 g/mol |
| Exact Mass | 581.25 |
| IUPAC Name | ethyl 2-[[2-[1-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]piperidin-4-yl]acetyl]amino]propanoate |
| SMILES | CCOC(=O)C(C)NC(=O)CC1CCN(c2ccc(NC(=O)c3ccccc3-c3ccc(C(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C32H34F3N3O4/c1-3-42-31(41)21(2)36-29(39)20-22-16-18-38(19-17-22)26-14-12-25(13-15-26)37-30(40)28-7-5-4-6-27(28)23-8-10-24(11-9-23)32(33,34)35/h4-15,21-22H,3,16-20H2,1-2H3,(H,36,39)(H,37,40) |
| InChIKey | LIIZZDVYCSWHNW-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.64 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|