C32H35F3N4O2 — CID 59446808
N-(cyclohexylmethyl)-4-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]piperazine-1-carboxamide (PubChem CID 59446808) has the molecular formula C32H35F3N4O2 and a molecular weight of 564.65 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-4-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]piperazine-1-carboxamide.
| Compound Name | N-(cyclohexylmethyl)-4-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 59446808 |
| Molecular Formula | C32H35F3N4O2 |
| Molecular Weight | 564.65 g/mol |
| Exact Mass | 564.27 |
| IUPAC Name | N-(cyclohexylmethyl)-4-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)NCC3CCCCC3)CC2)cc1)c1ccccc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C32H35F3N4O2/c33-32(34,35)25-12-10-24(11-13-25)28-8-4-5-9-29(28)30(40)37-26-14-16-27(17-15-26)38-18-20-39(21-19-38)31(41)36-22-23-6-2-1-3-7-23/h4-5,8-17,23H,1-3,6-7,18-22H2,(H,36,41)(H,37,40) |
| InChIKey | QTGFESMARIKESM-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.65 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|