C28H24F3N5O — CID 139942877
N-[4-[3-(pyrimidin-2-ylamino)pyrrolidin-1-yl]phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 139942877) has the molecular formula C28H24F3N5O and a molecular weight of 503.53 g/mol. Its IUPAC name is N-[4-[3-(pyrimidin-2-ylamino)pyrrolidin-1-yl]phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[4-[3-(pyrimidin-2-ylamino)pyrrolidin-1-yl]phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 139942877 |
| Molecular Formula | C28H24F3N5O |
| Molecular Weight | 503.53 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | N-[4-[3-(pyrimidin-2-ylamino)pyrrolidin-1-yl]phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(N2CCC(Nc3ncccn3)C2)cc1)c1ccccc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C28H24F3N5O/c29-28(30,31)20-8-6-19(7-9-20)24-4-1-2-5-25(24)26(37)34-21-10-12-23(13-11-21)36-17-14-22(18-36)35-27-32-15-3-16-33-27/h1-13,15-16,22H,14,17-18H2,(H,34,37)(H,32,33,35) |
| InChIKey | ZQPWELXXNDDBQQ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.53 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|