C34H33F3N4O2 — CID 58741445
N-[4-[3-[[2-(ethylamino)-2-oxo-1-phenylethyl]amino]pyrrolidin-1-yl]phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 58741445) has the molecular formula C34H33F3N4O2 and a molecular weight of 586.66 g/mol. Its IUPAC name is N-[4-[3-[[2-(ethylamino)-2-oxo-1-phenylethyl]amino]pyrrolidin-1-yl]phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[4-[3-[[2-(ethylamino)-2-oxo-1-phenylethyl]amino]pyrrolidin-1-yl]phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 58741445 |
| Molecular Formula | C34H33F3N4O2 |
| Molecular Weight | 586.66 g/mol |
| Exact Mass | 586.26 |
| IUPAC Name | N-[4-[3-[[2-(ethylamino)-2-oxo-1-phenylethyl]amino]pyrrolidin-1-yl]phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | CCNC(=O)C(NC1CCN(c2ccc(NC(=O)c3ccccc3-c3ccc(C(F)(F)F)cc3)cc2)C1)c1ccccc1 |
| InChI | InChI=1S/C34H33F3N4O2/c1-2-38-33(43)31(24-8-4-3-5-9-24)39-27-20-21-41(22-27)28-18-16-26(17-19-28)40-32(42)30-11-7-6-10-29(30)23-12-14-25(15-13-23)34(35,36)37/h3-19,27,31,39H,2,20-22H2,1H3,(H,38,43)(H,40,42) |
| InChIKey | CQVWPWLTCKYYAV-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.66 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|