C40H40F3N3O6 — CID 59127956
dimethyl 2-[[2-phenyl-2-[1-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]piperidin-4-yl]acetyl]amino]pentanedioate (PubChem CID 59127956) has the molecular formula C40H40F3N3O6 and a molecular weight of 715.77 g/mol. Its IUPAC name is dimethyl 2-[[2-phenyl-2-[1-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]piperidin-4-yl]acetyl]amino]pentanedioate.
| Compound Name | dimethyl 2-[[2-phenyl-2-[1-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]piperidin-4-yl]acetyl]amino]pentanedioate |
|---|---|
| PubChem CID | 59127956 |
| Molecular Formula | C40H40F3N3O6 |
| Molecular Weight | 715.77 g/mol |
| Exact Mass | 715.29 |
| IUPAC Name | dimethyl 2-[[2-phenyl-2-[1-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]piperidin-4-yl]acetyl]amino]pentanedioate |
| SMILES | COC(=O)CCC(NC(=O)C(c1ccccc1)C1CCN(c2ccc(NC(=O)c3ccccc3-c3ccc(C(F)(F)F)cc3)cc2)CC1)C(=O)OC |
| InChI | InChI=1S/C40H40F3N3O6/c1-51-35(47)21-20-34(39(50)52-2)45-38(49)36(27-8-4-3-5-9-27)28-22-24-46(25-23-28)31-18-16-30(17-19-31)44-37(48)33-11-7-6-10-32(33)26-12-14-29(15-13-26)40(41,42)43/h3-19,28,34,36H,20-25H2,1-2H3,(H,44,48)(H,45,49) |
| InChIKey | PMEVDCXGUXBPHN-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.77 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|