C34H35N3O3 — CID 58741451
methyl 2-[methyl-[1-[4-[(2-phenylbenzoyl)amino]phenyl]piperidin-4-yl]amino]-2-phenylacetate (PubChem CID 58741451) has the molecular formula C34H35N3O3 and a molecular weight of 533.67 g/mol. Its IUPAC name is methyl 2-[methyl-[1-[4-[(2-phenylbenzoyl)amino]phenyl]piperidin-4-yl]amino]-2-phenylacetate.
| Compound Name | methyl 2-[methyl-[1-[4-[(2-phenylbenzoyl)amino]phenyl]piperidin-4-yl]amino]-2-phenylacetate |
|---|---|
| PubChem CID | 58741451 |
| Molecular Formula | C34H35N3O3 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.27 |
| IUPAC Name | methyl 2-[methyl-[1-[4-[(2-phenylbenzoyl)amino]phenyl]piperidin-4-yl]amino]-2-phenylacetate |
| SMILES | COC(=O)C(c1ccccc1)N(C)C1CCN(c2ccc(NC(=O)c3ccccc3-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C34H35N3O3/c1-36(32(34(39)40-2)26-13-7-4-8-14-26)28-21-23-37(24-22-28)29-19-17-27(18-20-29)35-33(38)31-16-10-9-15-30(31)25-11-5-3-6-12-25/h3-20,28,32H,21-24H2,1-2H3,(H,35,38) |
| InChIKey | OMBJSLHEQXNYME-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|