C36H42N4O2 — CID 89185167
N-[4-[4-[methyl-[1-phenyl-2-(propylaminooxy)ethyl]amino]piperidin-1-yl]phenyl]-2-phenylbenzamide (PubChem CID 89185167) has the molecular formula C36H42N4O2 and a molecular weight of 562.76 g/mol. Its IUPAC name is N-[4-[4-[methyl-[1-phenyl-2-(propylaminooxy)ethyl]amino]piperidin-1-yl]phenyl]-2-phenylbenzamide.
| Compound Name | N-[4-[4-[methyl-[1-phenyl-2-(propylaminooxy)ethyl]amino]piperidin-1-yl]phenyl]-2-phenylbenzamide |
|---|---|
| PubChem CID | 89185167 |
| Molecular Formula | C36H42N4O2 |
| Molecular Weight | 562.76 g/mol |
| Exact Mass | 562.33 |
| IUPAC Name | N-[4-[4-[methyl-[1-phenyl-2-(propylaminooxy)ethyl]amino]piperidin-1-yl]phenyl]-2-phenylbenzamide |
| SMILES | CCCNOCC(c1ccccc1)N(C)C1CCN(c2ccc(NC(=O)c3ccccc3-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C36H42N4O2/c1-3-24-37-42-27-35(29-14-8-5-9-15-29)39(2)31-22-25-40(26-23-31)32-20-18-30(19-21-32)38-36(41)34-17-11-10-16-33(34)28-12-6-4-7-13-28/h4-21,31,35,37H,3,22-27H2,1-2H3,(H,38,41) |
| InChIKey | XDPNXTGGRNNUGO-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.76 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|