C39H38N4O2 — CID 20773824
2-(3-aminophenyl)-N-[4-[4-[2-(benzylamino)-2-oxo-1-phenylethyl]piperidin-1-yl]phenyl]benzamide (PubChem CID 20773824) has the molecular formula C39H38N4O2 and a molecular weight of 594.76 g/mol. Its IUPAC name is 2-(3-aminophenyl)-N-[4-[4-[2-(benzylamino)-2-oxo-1-phenylethyl]piperidin-1-yl]phenyl]benzamide.
| Compound Name | 2-(3-aminophenyl)-N-[4-[4-[2-(benzylamino)-2-oxo-1-phenylethyl]piperidin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 20773824 |
| Molecular Formula | C39H38N4O2 |
| Molecular Weight | 594.76 g/mol |
| Exact Mass | 594.30 |
| IUPAC Name | 2-(3-aminophenyl)-N-[4-[4-[2-(benzylamino)-2-oxo-1-phenylethyl]piperidin-1-yl]phenyl]benzamide |
| SMILES | Nc1cccc(-c2ccccc2C(=O)Nc2ccc(N3CCC(C(C(=O)NCc4ccccc4)c4ccccc4)CC3)cc2)c1 |
| InChI | InChI=1S/C39H38N4O2/c40-32-15-9-14-31(26-32)35-16-7-8-17-36(35)38(44)42-33-18-20-34(21-19-33)43-24-22-30(23-25-43)37(29-12-5-2-6-13-29)39(45)41-27-28-10-3-1-4-11-28/h1-21,26,30,37H,22-25,27,40H2,(H,41,45)(H,42,44) |
| InChIKey | PITQFMUQSCFLHC-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.76 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|