C33H33N3O2 — CID 58787317
N-[4-[4-[2-(benzylamino)-2-oxo-1-phenylethyl]piperidin-1-yl]phenyl]benzamide (PubChem CID 58787317) has the molecular formula C33H33N3O2 and a molecular weight of 503.65 g/mol. Its IUPAC name is N-[4-[4-[2-(benzylamino)-2-oxo-1-phenylethyl]piperidin-1-yl]phenyl]benzamide.
| Compound Name | N-[4-[4-[2-(benzylamino)-2-oxo-1-phenylethyl]piperidin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 58787317 |
| Molecular Formula | C33H33N3O2 |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.26 |
| IUPAC Name | N-[4-[4-[2-(benzylamino)-2-oxo-1-phenylethyl]piperidin-1-yl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(N2CCC(C(C(=O)NCc3ccccc3)c3ccccc3)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C33H33N3O2/c37-32(28-14-8-3-9-15-28)35-29-16-18-30(19-17-29)36-22-20-27(21-23-36)31(26-12-6-2-7-13-26)33(38)34-24-25-10-4-1-5-11-25/h1-19,27,31H,20-24H2,(H,34,38)(H,35,37) |
| InChIKey | HDDORXWISQMSAQ-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|