C24H30N2O2 — CID 95989343
(2R)-2-cyclohexyl-N-(4-morpholin-4-ylphenyl)-2-phenylacetamide (PubChem CID 95989343) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is (2R)-2-cyclohexyl-N-(4-morpholin-4-ylphenyl)-2-phenylacetamide.
| Compound Name | (2R)-2-cyclohexyl-N-(4-morpholin-4-ylphenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 95989343 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | (2R)-2-cyclohexyl-N-(4-morpholin-4-ylphenyl)-2-phenylacetamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)cc1)[C@@H](c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C24H30N2O2/c27-24(23(19-7-3-1-4-8-19)20-9-5-2-6-10-20)25-21-11-13-22(14-12-21)26-15-17-28-18-16-26/h1,3-4,7-8,11-14,20,23H,2,5-6,9-10,15-18H2,(H,25,27)/t23-/m0/s1 |
| InChIKey | OACDQUIFSGQFOU-QHCPKHFHSA-N |
| XLogP | 4.83 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|