C38H33Cl2N3O2 — CID 20773823
N-[4-[4-(2-anilino-2-oxo-1-phenylethyl)piperidin-1-yl]phenyl]-2-(3,5-dichlorophenyl)benzamide (PubChem CID 20773823) has the molecular formula C38H33Cl2N3O2 and a molecular weight of 634.61 g/mol. Its IUPAC name is N-[4-[4-(2-anilino-2-oxo-1-phenylethyl)piperidin-1-yl]phenyl]-2-(3,5-dichlorophenyl)benzamide.
| Compound Name | N-[4-[4-(2-anilino-2-oxo-1-phenylethyl)piperidin-1-yl]phenyl]-2-(3,5-dichlorophenyl)benzamide |
|---|---|
| PubChem CID | 20773823 |
| Molecular Formula | C38H33Cl2N3O2 |
| Molecular Weight | 634.61 g/mol |
| Exact Mass | 633.19 |
| IUPAC Name | N-[4-[4-(2-anilino-2-oxo-1-phenylethyl)piperidin-1-yl]phenyl]-2-(3,5-dichlorophenyl)benzamide |
| SMILES | O=C(Nc1ccc(N2CCC(C(C(=O)Nc3ccccc3)c3ccccc3)CC2)cc1)c1ccccc1-c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C38H33Cl2N3O2/c39-29-23-28(24-30(40)25-29)34-13-7-8-14-35(34)37(44)41-32-15-17-33(18-16-32)43-21-19-27(20-22-43)36(26-9-3-1-4-10-26)38(45)42-31-11-5-2-6-12-31/h1-18,23-25,27,36H,19-22H2,(H,41,44)(H,42,45) |
| InChIKey | ZSQAMFIHPGFBGS-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.61 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|