C40H45N3O2 — CID 142175359
2-[1-[4-[1-[2-(4-tert-butylphenyl)phenyl]ethenylamino]phenyl]piperidin-4-yl]-N-(2-oxopropyl)-2-phenylacetamide (PubChem CID 142175359) has the molecular formula C40H45N3O2 and a molecular weight of 599.82 g/mol. Its IUPAC name is 2-[1-[4-[1-[2-(4-tert-butylphenyl)phenyl]ethenylamino]phenyl]piperidin-4-yl]-N-(2-oxopropyl)-2-phenylacetamide.
| Compound Name | 2-[1-[4-[1-[2-(4-tert-butylphenyl)phenyl]ethenylamino]phenyl]piperidin-4-yl]-N-(2-oxopropyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 142175359 |
| Molecular Formula | C40H45N3O2 |
| Molecular Weight | 599.82 g/mol |
| Exact Mass | 599.35 |
| IUPAC Name | 2-[1-[4-[1-[2-(4-tert-butylphenyl)phenyl]ethenylamino]phenyl]piperidin-4-yl]-N-(2-oxopropyl)-2-phenylacetamide |
| SMILES | C=C(Nc1ccc(N2CCC(C(C(=O)NCC(C)=O)c3ccccc3)CC2)cc1)c1ccccc1-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C40H45N3O2/c1-28(44)27-41-39(45)38(31-11-7-6-8-12-31)32-23-25-43(26-24-32)35-21-19-34(20-22-35)42-29(2)36-13-9-10-14-37(36)30-15-17-33(18-16-30)40(3,4)5/h6-22,32,38,42H,2,23-27H2,1,3-5H3,(H,41,45) |
| InChIKey | PQFOWIVTQFQZRY-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.82 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|