C39H35ClN2O2 — CID 58495987
2-[1-[4-[2-[2-(4-chlorophenyl)phenyl]-2-oxoethyl]phenyl]piperidin-4-yl]-N,2-diphenylacetamide (PubChem CID 58495987) has the molecular formula C39H35ClN2O2 and a molecular weight of 599.17 g/mol. Its IUPAC name is 2-[1-[4-[2-[2-(4-chlorophenyl)phenyl]-2-oxoethyl]phenyl]piperidin-4-yl]-N,2-diphenylacetamide.
| Compound Name | 2-[1-[4-[2-[2-(4-chlorophenyl)phenyl]-2-oxoethyl]phenyl]piperidin-4-yl]-N,2-diphenylacetamide |
|---|---|
| PubChem CID | 58495987 |
| Molecular Formula | C39H35ClN2O2 |
| Molecular Weight | 599.17 g/mol |
| Exact Mass | 598.24 |
| IUPAC Name | 2-[1-[4-[2-[2-(4-chlorophenyl)phenyl]-2-oxoethyl]phenyl]piperidin-4-yl]-N,2-diphenylacetamide |
| SMILES | O=C(Cc1ccc(N2CCC(C(C(=O)Nc3ccccc3)c3ccccc3)CC2)cc1)c1ccccc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C39H35ClN2O2/c40-32-19-17-29(18-20-32)35-13-7-8-14-36(35)37(43)27-28-15-21-34(22-16-28)42-25-23-31(24-26-42)38(30-9-3-1-4-10-30)39(44)41-33-11-5-2-6-12-33/h1-22,31,38H,23-27H2,(H,41,44) |
| InChIKey | ALUXMLLVXQJHLZ-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.17 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|