C36H38N2O2 — CID 58495933
N-ethyl-2-[1-[4-[2-[2-(3-methylphenyl)phenyl]-2-oxoethyl]phenyl]piperidin-4-yl]-2-phenylacetamide (PubChem CID 58495933) has the molecular formula C36H38N2O2 and a molecular weight of 530.71 g/mol. Its IUPAC name is N-ethyl-2-[1-[4-[2-[2-(3-methylphenyl)phenyl]-2-oxoethyl]phenyl]piperidin-4-yl]-2-phenylacetamide.
| Compound Name | N-ethyl-2-[1-[4-[2-[2-(3-methylphenyl)phenyl]-2-oxoethyl]phenyl]piperidin-4-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 58495933 |
| Molecular Formula | C36H38N2O2 |
| Molecular Weight | 530.71 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | N-ethyl-2-[1-[4-[2-[2-(3-methylphenyl)phenyl]-2-oxoethyl]phenyl]piperidin-4-yl]-2-phenylacetamide |
| SMILES | CCNC(=O)C(c1ccccc1)C1CCN(c2ccc(CC(=O)c3ccccc3-c3cccc(C)c3)cc2)CC1 |
| InChI | InChI=1S/C36H38N2O2/c1-3-37-36(40)35(28-11-5-4-6-12-28)29-20-22-38(23-21-29)31-18-16-27(17-19-31)25-34(39)33-15-8-7-14-32(33)30-13-9-10-26(2)24-30/h4-19,24,29,35H,3,20-23,25H2,1-2H3,(H,37,40) |
| InChIKey | CSYWGNKQVHHIBF-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.71 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|