C32H31N3O3 — CID 58495898
methyl 2-[4-[4-[2-oxo-2-(2-pyridin-4-ylphenyl)ethyl]phenyl]piperazin-1-yl]-2-phenylacetate (PubChem CID 58495898) has the molecular formula C32H31N3O3 and a molecular weight of 505.62 g/mol. Its IUPAC name is methyl 2-[4-[4-[2-oxo-2-(2-pyridin-4-ylphenyl)ethyl]phenyl]piperazin-1-yl]-2-phenylacetate.
| Compound Name | methyl 2-[4-[4-[2-oxo-2-(2-pyridin-4-ylphenyl)ethyl]phenyl]piperazin-1-yl]-2-phenylacetate |
|---|---|
| PubChem CID | 58495898 |
| Molecular Formula | C32H31N3O3 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | methyl 2-[4-[4-[2-oxo-2-(2-pyridin-4-ylphenyl)ethyl]phenyl]piperazin-1-yl]-2-phenylacetate |
| SMILES | COC(=O)C(c1ccccc1)N1CCN(c2ccc(CC(=O)c3ccccc3-c3ccncc3)cc2)CC1 |
| InChI | InChI=1S/C32H31N3O3/c1-38-32(37)31(26-7-3-2-4-8-26)35-21-19-34(20-22-35)27-13-11-24(12-14-27)23-30(36)29-10-6-5-9-28(29)25-15-17-33-18-16-25/h2-18,31H,19-23H2,1H3 |
| InChIKey | BRAQBZYDLGIYBE-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|