C34H35N5O3 — CID 89203031
methyl 2-[4-[4-[amino-[phenyl(1-phenylethenyl)carbamoyl]amino]phenyl]piperazin-1-yl]-2-phenylacetate (PubChem CID 89203031) has the molecular formula C34H35N5O3 and a molecular weight of 561.69 g/mol. Its IUPAC name is methyl 2-[4-[4-[amino-[phenyl(1-phenylethenyl)carbamoyl]amino]phenyl]piperazin-1-yl]-2-phenylacetate.
| Compound Name | methyl 2-[4-[4-[amino-[phenyl(1-phenylethenyl)carbamoyl]amino]phenyl]piperazin-1-yl]-2-phenylacetate |
|---|---|
| PubChem CID | 89203031 |
| Molecular Formula | C34H35N5O3 |
| Molecular Weight | 561.69 g/mol |
| Exact Mass | 561.27 |
| IUPAC Name | methyl 2-[4-[4-[amino-[phenyl(1-phenylethenyl)carbamoyl]amino]phenyl]piperazin-1-yl]-2-phenylacetate |
| SMILES | C=C(c1ccccc1)N(C(=O)N(N)c1ccc(N2CCN(C(C(=O)OC)c3ccccc3)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C34H35N5O3/c1-26(27-12-6-3-7-13-27)38(30-16-10-5-11-17-30)34(41)39(35)31-20-18-29(19-21-31)36-22-24-37(25-23-36)32(33(40)42-2)28-14-8-4-9-15-28/h3-21,32H,1,22-25,35H2,2H3 |
| InChIKey | KXBQMBUKDVCGMC-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.69 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|