About methyl 2-(4-fluorophenyl)-2-(4-phenylpiperazin-1-yl)acetate bromide
methyl 2-(4-fluorophenyl)-2-(4-phenylpiperazin-1-yl)acetate bromide (PubChem CID 43831496) has the molecular formula C19H21BrFN2O2-
and a molecular weight of 408.29 g/mol. Its IUPAC name is methyl 2-(4-fluorophenyl)-2-(4-phenylpiperazin-1-yl)acetate bromide.
Molecular Properties
| Compound Name | methyl 2-(4-fluorophenyl)-2-(4-phenylpiperazin-1-yl)acetate bromide |
| PubChem CID | 43831496 |
| Molecular Formula | C19H21BrFN2O2- |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | methyl 2-(4-fluorophenyl)-2-(4-phenylpiperazin-1-yl)acetate bromide |
| SMILES | COC(=O)C(c1ccc(F)cc1)N1CCN(c2ccccc2)CC1.[Br-] |
| InChI | InChI=1S/C19H21FN2O2.BrH/c1-24-19(23)18(15-7-9-16(20)10-8-15)22-13-11-21(12-14-22)17-5-3-2-4-6-17;/h2-10,18H,11-14H2,1H3;1H/p-1 |
| InChIKey | HNFXRSPOJBZOMP-UHFFFAOYSA-M |
| XLogP | -0.13 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-(4-fluorophenyl)-2-(4-phenylpiperazin-1-yl)acetate bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(4-fluorophenyl)-2-(4-phenylpiperazin-1-yl)acetate bromide?
The IUPAC name of methyl 2-(4-fluorophenyl)-2-(4-phenylpiperazin-1-yl)acetate bromide (CID 43831496) is methyl 2-(4-fluorophenyl)-2-(4-phenylpiperazin-1-yl)acetate bromide.
What is the SMILES notation for methyl 2-(4-fluorophenyl)-2-(4-phenylpiperazin-1-yl)acetate bromide?
The canonical SMILES for methyl 2-(4-fluorophenyl)-2-(4-phenylpiperazin-1-yl)acetate bromide is COC(=O)C(c1ccc(F)cc1)N1CCN(c2ccccc2)CC1.[Br-].
What is the InChIKey of methyl 2-(4-fluorophenyl)-2-(4-phenylpiperazin-1-yl)acetate bromide?
The InChIKey is HNFXRSPOJBZOMP-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H21FN2O2.BrH/c1-24-19(23)18(15-7-9-16(20)10-8-15)22-13-11-21(12-14-22)17-5-3-2-4-6-17;/h2-10,18H,11-14H2,1H3;1H/p-1.
What are the key properties of methyl 2-(4-fluorophenyl)-2-(4-phenylpiperazin-1-yl)acetate bromide?
methyl 2-(4-fluorophenyl)-2-(4-phenylpiperazin-1-yl)acetate bromide has a molecular weight of 408.29 g/mol, XLogP of -0.13, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4-fluorophenyl)-2-(4-phenylpiperazin-1-yl)acetate bromide is sourced from PubChem (CID 43831496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).