C29H42N6O2 — CID 89022584
2-[4-[4-[amino-[ethenyl(propan-2-yl)carbamoyl]amino]phenyl]piperazin-1-yl]-N-pentyl-2-phenylacetamide (PubChem CID 89022584) has the molecular formula C29H42N6O2 and a molecular weight of 506.70 g/mol. Its IUPAC name is 2-[4-[4-[amino-[ethenyl(propan-2-yl)carbamoyl]amino]phenyl]piperazin-1-yl]-N-pentyl-2-phenylacetamide.
| Compound Name | 2-[4-[4-[amino-[ethenyl(propan-2-yl)carbamoyl]amino]phenyl]piperazin-1-yl]-N-pentyl-2-phenylacetamide |
|---|---|
| PubChem CID | 89022584 |
| Molecular Formula | C29H42N6O2 |
| Molecular Weight | 506.70 g/mol |
| Exact Mass | 506.34 |
| IUPAC Name | 2-[4-[4-[amino-[ethenyl(propan-2-yl)carbamoyl]amino]phenyl]piperazin-1-yl]-N-pentyl-2-phenylacetamide |
| SMILES | C=CN(C(=O)N(N)c1ccc(N2CCN(C(C(=O)NCCCCC)c3ccccc3)CC2)cc1)C(C)C |
| InChI | InChI=1S/C29H42N6O2/c1-5-7-11-18-31-28(36)27(24-12-9-8-10-13-24)33-21-19-32(20-22-33)25-14-16-26(17-15-25)35(30)29(37)34(6-2)23(3)4/h6,8-10,12-17,23,27H,2,5,7,11,18-22,30H2,1,3-4H3,(H,31,36) |
| InChIKey | JBPMJUBYQBUPAS-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.70 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|