C39H41FN4O6 — CID 123379903
(Z)-but-2-enedioic acid;N,N-diethyl-2-[4-[2-fluoro-4-[2-oxo-2-(2-pyridin-3-ylphenyl)ethyl]phenyl]piperazin-1-yl]-2-phenylacetamide (PubChem CID 123379903) has the molecular formula C39H41FN4O6 and a molecular weight of 680.78 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;N,N-diethyl-2-[4-[2-fluoro-4-[2-oxo-2-(2-pyridin-3-ylphenyl)ethyl]phenyl]piperazin-1-yl]-2-phenylacetamide.
| Compound Name | (Z)-but-2-enedioic acid;N,N-diethyl-2-[4-[2-fluoro-4-[2-oxo-2-(2-pyridin-3-ylphenyl)ethyl]phenyl]piperazin-1-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 123379903 |
| Molecular Formula | C39H41FN4O6 |
| Molecular Weight | 680.78 g/mol |
| Exact Mass | 680.30 |
| IUPAC Name | (Z)-but-2-enedioic acid;N,N-diethyl-2-[4-[2-fluoro-4-[2-oxo-2-(2-pyridin-3-ylphenyl)ethyl]phenyl]piperazin-1-yl]-2-phenylacetamide |
| SMILES | CCN(CC)C(=O)C(c1ccccc1)N1CCN(c2ccc(CC(=O)c3ccccc3-c3cccnc3)cc2F)CC1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C35H37FN4O2.C4H4O4/c1-3-38(4-2)35(42)34(27-11-6-5-7-12-27)40-21-19-39(20-22-40)32-17-16-26(23-31(32)36)24-33(41)30-15-9-8-14-29(30)28-13-10-18-37-25-28;5-3(6)1-2-4(7)8/h5-18,23,25,34H,3-4,19-22,24H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | VDOSVLLLJNREHV-BTJKTKAUSA-N |
| XLogP | 5.76 |
| TPSA | 131.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.78 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|