C27H35FN4O2 — CID 58870720
N-[4-[4-[2-(diethylamino)-2-oxo-1-phenylethyl]piperazin-1-yl]-3-fluorophenyl]-2-methylcyclopropane-1-carboxamide (PubChem CID 58870720) has the molecular formula C27H35FN4O2 and a molecular weight of 466.60 g/mol. Its IUPAC name is N-[4-[4-[2-(diethylamino)-2-oxo-1-phenylethyl]piperazin-1-yl]-3-fluorophenyl]-2-methylcyclopropane-1-carboxamide.
| Compound Name | N-[4-[4-[2-(diethylamino)-2-oxo-1-phenylethyl]piperazin-1-yl]-3-fluorophenyl]-2-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 58870720 |
| Molecular Formula | C27H35FN4O2 |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | N-[4-[4-[2-(diethylamino)-2-oxo-1-phenylethyl]piperazin-1-yl]-3-fluorophenyl]-2-methylcyclopropane-1-carboxamide |
| SMILES | CCN(CC)C(=O)C(c1ccccc1)N1CCN(c2ccc(NC(=O)C3CC3C)cc2F)CC1 |
| InChI | InChI=1S/C27H35FN4O2/c1-4-30(5-2)27(34)25(20-9-7-6-8-10-20)32-15-13-31(14-16-32)24-12-11-21(18-23(24)28)29-26(33)22-17-19(22)3/h6-12,18-19,22,25H,4-5,13-17H2,1-3H3,(H,29,33) |
| InChIKey | LXDRHZLNFHQHNH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|