C29H38FN5O2 — CID 69305104
N-[4-[4-[1-(4-cyanophenyl)-2-(diethylamino)-2-oxoethyl]piperazin-1-yl]-3-fluorophenyl]-2-ethylbutanamide (PubChem CID 69305104) has the molecular formula C29H38FN5O2 and a molecular weight of 507.65 g/mol. Its IUPAC name is N-[4-[4-[1-(4-cyanophenyl)-2-(diethylamino)-2-oxoethyl]piperazin-1-yl]-3-fluorophenyl]-2-ethylbutanamide.
| Compound Name | N-[4-[4-[1-(4-cyanophenyl)-2-(diethylamino)-2-oxoethyl]piperazin-1-yl]-3-fluorophenyl]-2-ethylbutanamide |
|---|---|
| PubChem CID | 69305104 |
| Molecular Formula | C29H38FN5O2 |
| Molecular Weight | 507.65 g/mol |
| Exact Mass | 507.30 |
| IUPAC Name | N-[4-[4-[1-(4-cyanophenyl)-2-(diethylamino)-2-oxoethyl]piperazin-1-yl]-3-fluorophenyl]-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)Nc1ccc(N2CCN(C(C(=O)N(CC)CC)c3ccc(C#N)cc3)CC2)c(F)c1 |
| InChI | InChI=1S/C29H38FN5O2/c1-5-22(6-2)28(36)32-24-13-14-26(25(30)19-24)34-15-17-35(18-16-34)27(29(37)33(7-3)8-4)23-11-9-21(20-31)10-12-23/h9-14,19,22,27H,5-8,15-18H2,1-4H3,(H,32,36) |
| InChIKey | CEDAKPOHYDUPNB-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 79.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.65 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|