C27H32FN5O — CID 68933477
N-[4-[4-(dipyridin-2-ylmethyl)piperazin-1-yl]-3-fluorophenyl]-2-ethylbutanamide (PubChem CID 68933477) has the molecular formula C27H32FN5O and a molecular weight of 461.59 g/mol. Its IUPAC name is N-[4-[4-(dipyridin-2-ylmethyl)piperazin-1-yl]-3-fluorophenyl]-2-ethylbutanamide.
| Compound Name | N-[4-[4-(dipyridin-2-ylmethyl)piperazin-1-yl]-3-fluorophenyl]-2-ethylbutanamide |
|---|---|
| PubChem CID | 68933477 |
| Molecular Formula | C27H32FN5O |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | N-[4-[4-(dipyridin-2-ylmethyl)piperazin-1-yl]-3-fluorophenyl]-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)Nc1ccc(N2CCN(C(c3ccccn3)c3ccccn3)CC2)c(F)c1 |
| InChI | InChI=1S/C27H32FN5O/c1-3-20(4-2)27(34)31-21-11-12-25(22(28)19-21)32-15-17-33(18-16-32)26(23-9-5-7-13-29-23)24-10-6-8-14-30-24/h5-14,19-20,26H,3-4,15-18H2,1-2H3,(H,31,34) |
| InChIKey | WWQDGMCUSBXBIS-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|