C26H32FN5O2 — CID 67678645
2-ethyl-N-[3-fluoro-4-[4-[(5-methyl-1,3,4-oxadiazol-2-yl)-phenylmethyl]piperazin-1-yl]phenyl]butanamide (PubChem CID 67678645) has the molecular formula C26H32FN5O2 and a molecular weight of 465.57 g/mol. Its IUPAC name is 2-ethyl-N-[3-fluoro-4-[4-[(5-methyl-1,3,4-oxadiazol-2-yl)-phenylmethyl]piperazin-1-yl]phenyl]butanamide.
| Compound Name | 2-ethyl-N-[3-fluoro-4-[4-[(5-methyl-1,3,4-oxadiazol-2-yl)-phenylmethyl]piperazin-1-yl]phenyl]butanamide |
|---|---|
| PubChem CID | 67678645 |
| Molecular Formula | C26H32FN5O2 |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | 2-ethyl-N-[3-fluoro-4-[4-[(5-methyl-1,3,4-oxadiazol-2-yl)-phenylmethyl]piperazin-1-yl]phenyl]butanamide |
| SMILES | CCC(CC)C(=O)Nc1ccc(N2CCN(C(c3ccccc3)c3nnc(C)o3)CC2)c(F)c1 |
| InChI | InChI=1S/C26H32FN5O2/c1-4-19(5-2)25(33)28-21-11-12-23(22(27)17-21)31-13-15-32(16-14-31)24(20-9-7-6-8-10-20)26-30-29-18(3)34-26/h6-12,17,19,24H,4-5,13-16H2,1-3H3,(H,28,33) |
| InChIKey | CVCZMFLULQMOCN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|