C27H34FN3O5 — CID 58870663
methyl 4-[4-(2-ethylbutanoylamino)-2-fluorophenyl]-1-(2-methoxy-2-oxo-1-phenylethyl)piperazine-2-carboxylate (PubChem CID 58870663) has the molecular formula C27H34FN3O5 and a molecular weight of 499.58 g/mol. Its IUPAC name is methyl 4-[4-(2-ethylbutanoylamino)-2-fluorophenyl]-1-(2-methoxy-2-oxo-1-phenylethyl)piperazine-2-carboxylate.
| Compound Name | methyl 4-[4-(2-ethylbutanoylamino)-2-fluorophenyl]-1-(2-methoxy-2-oxo-1-phenylethyl)piperazine-2-carboxylate |
|---|---|
| PubChem CID | 58870663 |
| Molecular Formula | C27H34FN3O5 |
| Molecular Weight | 499.58 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | methyl 4-[4-(2-ethylbutanoylamino)-2-fluorophenyl]-1-(2-methoxy-2-oxo-1-phenylethyl)piperazine-2-carboxylate |
| SMILES | CCC(CC)C(=O)Nc1ccc(N2CCN(C(C(=O)OC)c3ccccc3)C(C(=O)OC)C2)c(F)c1 |
| InChI | InChI=1S/C27H34FN3O5/c1-5-18(6-2)25(32)29-20-12-13-22(21(28)16-20)30-14-15-31(23(17-30)26(33)35-3)24(27(34)36-4)19-10-8-7-9-11-19/h7-13,16,18,23-24H,5-6,14-15,17H2,1-4H3,(H,29,32) |
| InChIKey | IMRWXTRWIRNQFI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.58 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|