C29H36FN3O5 — CID 69304061
methyl 1-[1-(1,3-dioxol-4-yl)-2-phenylethyl]-4-[4-(2-ethylbutanoylamino)-2-fluorophenyl]piperazine-2-carboxylate (PubChem CID 69304061) has the molecular formula C29H36FN3O5 and a molecular weight of 525.62 g/mol. Its IUPAC name is methyl 1-[1-(1,3-dioxol-4-yl)-2-phenylethyl]-4-[4-(2-ethylbutanoylamino)-2-fluorophenyl]piperazine-2-carboxylate.
| Compound Name | methyl 1-[1-(1,3-dioxol-4-yl)-2-phenylethyl]-4-[4-(2-ethylbutanoylamino)-2-fluorophenyl]piperazine-2-carboxylate |
|---|---|
| PubChem CID | 69304061 |
| Molecular Formula | C29H36FN3O5 |
| Molecular Weight | 525.62 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | methyl 1-[1-(1,3-dioxol-4-yl)-2-phenylethyl]-4-[4-(2-ethylbutanoylamino)-2-fluorophenyl]piperazine-2-carboxylate |
| SMILES | CCC(CC)C(=O)Nc1ccc(N2CCN(C(Cc3ccccc3)C3=COCO3)C(C(=O)OC)C2)c(F)c1 |
| InChI | InChI=1S/C29H36FN3O5/c1-4-21(5-2)28(34)31-22-11-12-24(23(30)16-22)32-13-14-33(26(17-32)29(35)36-3)25(27-18-37-19-38-27)15-20-9-7-6-8-10-20/h6-12,16,18,21,25-26H,4-5,13-15,17,19H2,1-3H3,(H,31,34) |
| InChIKey | CKKOYBBWJBWATL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.62 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|