C29H40FN3O2 — CID 16667137
N-[4-[4-[2-(ethylamino)-2-oxo-1-phenylethyl]piperidin-1-yl]-3-fluorophenyl]-2-propylpentanamide (PubChem CID 16667137) has the molecular formula C29H40FN3O2 and a molecular weight of 481.66 g/mol. Its IUPAC name is N-[4-[4-[2-(ethylamino)-2-oxo-1-phenylethyl]piperidin-1-yl]-3-fluorophenyl]-2-propylpentanamide.
| Compound Name | N-[4-[4-[2-(ethylamino)-2-oxo-1-phenylethyl]piperidin-1-yl]-3-fluorophenyl]-2-propylpentanamide |
|---|---|
| PubChem CID | 16667137 |
| Molecular Formula | C29H40FN3O2 |
| Molecular Weight | 481.66 g/mol |
| Exact Mass | 481.31 |
| IUPAC Name | N-[4-[4-[2-(ethylamino)-2-oxo-1-phenylethyl]piperidin-1-yl]-3-fluorophenyl]-2-propylpentanamide |
| SMILES | CCCC(CCC)C(=O)Nc1ccc(N2CCC(C(C(=O)NCC)c3ccccc3)CC2)c(F)c1 |
| InChI | InChI=1S/C29H40FN3O2/c1-4-10-23(11-5-2)28(34)32-24-14-15-26(25(30)20-24)33-18-16-22(17-19-33)27(29(35)31-6-3)21-12-8-7-9-13-21/h7-9,12-15,20,22-23,27H,4-6,10-11,16-19H2,1-3H3,(H,31,35)(H,32,34) |
| InChIKey | GDASUGFIYLAYQP-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.66 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|