C32H32FN5O2 — CID 25152075
N-[4-[4-[(1R)-2-(ethylamino)-2-oxo-1-phenylethyl]piperazin-1-yl]-3-fluorophenyl]-2-pyridin-3-ylbenzamide (PubChem CID 25152075) has the molecular formula C32H32FN5O2 and a molecular weight of 537.64 g/mol. Its IUPAC name is N-[4-[4-[(1R)-2-(ethylamino)-2-oxo-1-phenylethyl]piperazin-1-yl]-3-fluorophenyl]-2-pyridin-3-ylbenzamide.
| Compound Name | N-[4-[4-[(1R)-2-(ethylamino)-2-oxo-1-phenylethyl]piperazin-1-yl]-3-fluorophenyl]-2-pyridin-3-ylbenzamide |
|---|---|
| PubChem CID | 25152075 |
| Molecular Formula | C32H32FN5O2 |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | N-[4-[4-[(1R)-2-(ethylamino)-2-oxo-1-phenylethyl]piperazin-1-yl]-3-fluorophenyl]-2-pyridin-3-ylbenzamide |
| SMILES | CCNC(=O)[C@@H](c1ccccc1)N1CCN(c2ccc(NC(=O)c3ccccc3-c3cccnc3)cc2F)CC1 |
| InChI | InChI=1S/C32H32FN5O2/c1-2-35-32(40)30(23-9-4-3-5-10-23)38-19-17-37(18-20-38)29-15-14-25(21-28(29)33)36-31(39)27-13-7-6-12-26(27)24-11-8-16-34-22-24/h3-16,21-22,30H,2,17-20H2,1H3,(H,35,40)(H,36,39)/t30-/m1/s1 |
| InChIKey | YYUXPUISOAQNJU-SSEXGKCCSA-N |
| XLogP | 5.14 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|