C35H35F3N4O2 — CID 20774054
N-[4-[4-[2-(ethylamino)-2-oxo-1-phenylethyl]piperazin-1-yl]phenyl]-4-methyl-2-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 20774054) has the molecular formula C35H35F3N4O2 and a molecular weight of 600.69 g/mol. Its IUPAC name is N-[4-[4-[2-(ethylamino)-2-oxo-1-phenylethyl]piperazin-1-yl]phenyl]-4-methyl-2-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[4-[4-[2-(ethylamino)-2-oxo-1-phenylethyl]piperazin-1-yl]phenyl]-4-methyl-2-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 20774054 |
| Molecular Formula | C35H35F3N4O2 |
| Molecular Weight | 600.69 g/mol |
| Exact Mass | 600.27 |
| IUPAC Name | N-[4-[4-[2-(ethylamino)-2-oxo-1-phenylethyl]piperazin-1-yl]phenyl]-4-methyl-2-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | CCNC(=O)C(c1ccccc1)N1CCN(c2ccc(NC(=O)c3ccc(C)cc3-c3ccc(C(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C35H35F3N4O2/c1-3-39-34(44)32(26-7-5-4-6-8-26)42-21-19-41(20-22-42)29-16-14-28(15-17-29)40-33(43)30-18-9-24(2)23-31(30)25-10-12-27(13-11-25)35(36,37)38/h4-18,23,32H,3,19-22H2,1-2H3,(H,39,44)(H,40,43) |
| InChIKey | GNEKPKBCUYUDRA-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.69 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|