C28H30F3N3O — CID 10277567
4-methyl-N-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 10277567) has the molecular formula C28H30F3N3O and a molecular weight of 481.56 g/mol. Its IUPAC name is 4-methyl-N-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-methyl-N-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 10277567 |
| Molecular Formula | C28H30F3N3O |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | 4-methyl-N-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(N3CCN(C(C)C)CC3)cc2)c(-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C28H30F3N3O/c1-19(2)33-14-16-34(17-15-33)24-11-9-23(10-12-24)32-27(35)25-13-4-20(3)18-26(25)21-5-7-22(8-6-21)28(29,30)31/h4-13,18-19H,14-17H2,1-3H3,(H,32,35) |
| InChIKey | KUVBNAMBJGUEFB-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|