C30H37N3O2 — CID 10116194
4-methoxy-2-(4-propan-2-ylphenyl)-N-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]benzamide (PubChem CID 10116194) has the molecular formula C30H37N3O2 and a molecular weight of 471.65 g/mol. Its IUPAC name is 4-methoxy-2-(4-propan-2-ylphenyl)-N-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]benzamide.
| Compound Name | 4-methoxy-2-(4-propan-2-ylphenyl)-N-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 10116194 |
| Molecular Formula | C30H37N3O2 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.29 |
| IUPAC Name | 4-methoxy-2-(4-propan-2-ylphenyl)-N-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(N3CCN(C(C)C)CC3)cc2)c(-c2ccc(C(C)C)cc2)c1 |
| InChI | InChI=1S/C30H37N3O2/c1-21(2)23-6-8-24(9-7-23)29-20-27(35-5)14-15-28(29)30(34)31-25-10-12-26(13-11-25)33-18-16-32(17-19-33)22(3)4/h6-15,20-22H,16-19H2,1-5H3,(H,31,34) |
| InChIKey | GELPLASGOXKFQY-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|