C27H31N3O2 — CID 11362426
3-methoxy-N-(4-piperazin-1-ylphenyl)-2-(4-propan-2-ylphenyl)benzamide (PubChem CID 11362426) has the molecular formula C27H31N3O2 and a molecular weight of 429.56 g/mol. Its IUPAC name is 3-methoxy-N-(4-piperazin-1-ylphenyl)-2-(4-propan-2-ylphenyl)benzamide.
| Compound Name | 3-methoxy-N-(4-piperazin-1-ylphenyl)-2-(4-propan-2-ylphenyl)benzamide |
|---|---|
| PubChem CID | 11362426 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 3-methoxy-N-(4-piperazin-1-ylphenyl)-2-(4-propan-2-ylphenyl)benzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc(N3CCNCC3)cc2)c1-c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C27H31N3O2/c1-19(2)20-7-9-21(10-8-20)26-24(5-4-6-25(26)32-3)27(31)29-22-11-13-23(14-12-22)30-17-15-28-16-18-30/h4-14,19,28H,15-18H2,1-3H3,(H,29,31) |
| InChIKey | TXCITRASNHBORJ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|