C36H40FN3O — CID 142248904
N-[4-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]phenyl]-3-propan-2-yl-2-(4-propan-2-ylphenyl)benzamide (PubChem CID 142248904) has the molecular formula C36H40FN3O and a molecular weight of 549.73 g/mol. Its IUPAC name is N-[4-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]phenyl]-3-propan-2-yl-2-(4-propan-2-ylphenyl)benzamide.
| Compound Name | N-[4-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]phenyl]-3-propan-2-yl-2-(4-propan-2-ylphenyl)benzamide |
|---|---|
| PubChem CID | 142248904 |
| Molecular Formula | C36H40FN3O |
| Molecular Weight | 549.73 g/mol |
| Exact Mass | 549.32 |
| IUPAC Name | N-[4-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]phenyl]-3-propan-2-yl-2-(4-propan-2-ylphenyl)benzamide |
| SMILES | CC(C)c1ccc(-c2c(C(=O)Nc3ccc(N4CCN(Cc5cccc(F)c5)CC4)cc3)cccc2C(C)C)cc1 |
| InChI | InChI=1S/C36H40FN3O/c1-25(2)28-11-13-29(14-12-28)35-33(26(3)4)9-6-10-34(35)36(41)38-31-15-17-32(18-16-31)40-21-19-39(20-22-40)24-27-7-5-8-30(37)23-27/h5-18,23,25-26H,19-22,24H2,1-4H3,(H,38,41) |
| InChIKey | MPSPDQGKMBBXTH-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.73 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|