C31H31N3O — CID 141188313
N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-methyl-3-phenylbenzamide (PubChem CID 141188313) has the molecular formula C31H31N3O and a molecular weight of 461.61 g/mol. Its IUPAC name is N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-methyl-3-phenylbenzamide.
| Compound Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-methyl-3-phenylbenzamide |
|---|---|
| PubChem CID | 141188313 |
| Molecular Formula | C31H31N3O |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-methyl-3-phenylbenzamide |
| SMILES | Cc1c(C(=O)Nc2ccc(N3CCN(Cc4ccccc4)CC3)cc2)cccc1-c1ccccc1 |
| InChI | InChI=1S/C31H31N3O/c1-24-29(26-11-6-3-7-12-26)13-8-14-30(24)31(35)32-27-15-17-28(18-16-27)34-21-19-33(20-22-34)23-25-9-4-2-5-10-25/h2-18H,19-23H2,1H3,(H,32,35) |
| InChIKey | RALDOEITXUNZCZ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|