C19H21F2N3O2 — CID 30857280
2-(difluoromethoxy)-N-[4-(4-methylpiperazin-1-yl)phenyl]benzamide (PubChem CID 30857280) has the molecular formula C19H21F2N3O2 and a molecular weight of 361.39 g/mol. Its IUPAC name is 2-(difluoromethoxy)-N-[4-(4-methylpiperazin-1-yl)phenyl]benzamide.
| Compound Name | 2-(difluoromethoxy)-N-[4-(4-methylpiperazin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 30857280 |
| Molecular Formula | C19H21F2N3O2 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 2-(difluoromethoxy)-N-[4-(4-methylpiperazin-1-yl)phenyl]benzamide |
| SMILES | CN1CCN(c2ccc(NC(=O)c3ccccc3OC(F)F)cc2)CC1 |
| InChI | InChI=1S/C19H21F2N3O2/c1-23-10-12-24(13-11-23)15-8-6-14(7-9-15)22-18(25)16-4-2-3-5-17(16)26-19(20)21/h2-9,19H,10-13H2,1H3,(H,22,25) |
| InChIKey | RCUWUMIHRPWATR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|