C20H23F2NO2 — CID 8778786
2-(difluoromethoxy)-N-[2,6-di(propan-2-yl)phenyl]benzamide (PubChem CID 8778786) has the molecular formula C20H23F2NO2 and a molecular weight of 347.41 g/mol. Its IUPAC name is 2-(difluoromethoxy)-N-[2,6-di(propan-2-yl)phenyl]benzamide.
| Compound Name | 2-(difluoromethoxy)-N-[2,6-di(propan-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 8778786 |
| Molecular Formula | C20H23F2NO2 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 2-(difluoromethoxy)-N-[2,6-di(propan-2-yl)phenyl]benzamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)c1ccccc1OC(F)F |
| InChI | InChI=1S/C20H23F2NO2/c1-12(2)14-9-7-10-15(13(3)4)18(14)23-19(24)16-8-5-6-11-17(16)25-20(21)22/h5-13,20H,1-4H3,(H,23,24) |
| InChIKey | SETRYCIVVKZPKI-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |