C19H23NO2 — CID 4106952
2-ethoxy-N-(2-methyl-6-propan-2-ylphenyl)benzamide (PubChem CID 4106952) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 2-ethoxy-N-(2-methyl-6-propan-2-ylphenyl)benzamide.
| Compound Name | 2-ethoxy-N-(2-methyl-6-propan-2-ylphenyl)benzamide |
|---|---|
| PubChem CID | 4106952 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 2-ethoxy-N-(2-methyl-6-propan-2-ylphenyl)benzamide |
| SMILES | CCOc1ccccc1C(=O)Nc1c(C)cccc1C(C)C |
| InChI | InChI=1S/C19H23NO2/c1-5-22-17-12-7-6-10-16(17)19(21)20-18-14(4)9-8-11-15(18)13(2)3/h6-13H,5H2,1-4H3,(H,20,21) |
| InChIKey | VYQVXXVHEUNZMY-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |