C27H30FN3O4S — CID 3585654
2-fluoro-5-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl-N-(4-propan-2-ylphenyl)benzamide (PubChem CID 3585654) has the molecular formula C27H30FN3O4S and a molecular weight of 511.62 g/mol. Its IUPAC name is 2-fluoro-5-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl-N-(4-propan-2-ylphenyl)benzamide.
| Compound Name | 2-fluoro-5-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl-N-(4-propan-2-ylphenyl)benzamide |
|---|---|
| PubChem CID | 3585654 |
| Molecular Formula | C27H30FN3O4S |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | 2-fluoro-5-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl-N-(4-propan-2-ylphenyl)benzamide |
| SMILES | COc1ccc(N2CCN(S(=O)(=O)c3ccc(F)c(C(=O)Nc4ccc(C(C)C)cc4)c3)CC2)cc1 |
| InChI | InChI=1S/C27H30FN3O4S/c1-19(2)20-4-6-21(7-5-20)29-27(32)25-18-24(12-13-26(25)28)36(33,34)31-16-14-30(15-17-31)22-8-10-23(35-3)11-9-22/h4-13,18-19H,14-17H2,1-3H3,(H,29,32) |
| InChIKey | IKLGBODSSKCFGB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|