C35H33F3N4O2 — CID 20773998
N-[4-[4-[2-oxo-1-phenyl-2-(prop-2-enylamino)ethyl]piperazin-1-yl]phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 20773998) has the molecular formula C35H33F3N4O2 and a molecular weight of 598.67 g/mol. Its IUPAC name is N-[4-[4-[2-oxo-1-phenyl-2-(prop-2-enylamino)ethyl]piperazin-1-yl]phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[4-[4-[2-oxo-1-phenyl-2-(prop-2-enylamino)ethyl]piperazin-1-yl]phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 20773998 |
| Molecular Formula | C35H33F3N4O2 |
| Molecular Weight | 598.67 g/mol |
| Exact Mass | 598.26 |
| IUPAC Name | N-[4-[4-[2-oxo-1-phenyl-2-(prop-2-enylamino)ethyl]piperazin-1-yl]phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | C=CCNC(=O)C(c1ccccc1)N1CCN(c2ccc(NC(=O)c3ccccc3-c3ccc(C(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C35H33F3N4O2/c1-2-20-39-34(44)32(26-8-4-3-5-9-26)42-23-21-41(22-24-42)29-18-16-28(17-19-29)40-33(43)31-11-7-6-10-30(31)25-12-14-27(15-13-25)35(36,37)38/h2-19,32H,1,20-24H2,(H,39,44)(H,40,43) |
| InChIKey | KGJDBPVSGNLHTE-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.67 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|