C35H33N3O2 — CID 20773969
N-[4-[1-[2-oxo-1-phenyl-2-(prop-2-enylamino)ethyl]-3,6-dihydro-2H-pyridin-4-yl]phenyl]-2-phenylbenzamide (PubChem CID 20773969) has the molecular formula C35H33N3O2 and a molecular weight of 527.67 g/mol. Its IUPAC name is N-[4-[1-[2-oxo-1-phenyl-2-(prop-2-enylamino)ethyl]-3,6-dihydro-2H-pyridin-4-yl]phenyl]-2-phenylbenzamide.
| Compound Name | N-[4-[1-[2-oxo-1-phenyl-2-(prop-2-enylamino)ethyl]-3,6-dihydro-2H-pyridin-4-yl]phenyl]-2-phenylbenzamide |
|---|---|
| PubChem CID | 20773969 |
| Molecular Formula | C35H33N3O2 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | N-[4-[1-[2-oxo-1-phenyl-2-(prop-2-enylamino)ethyl]-3,6-dihydro-2H-pyridin-4-yl]phenyl]-2-phenylbenzamide |
| SMILES | C=CCNC(=O)C(c1ccccc1)N1CC=C(c2ccc(NC(=O)c3ccccc3-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C35H33N3O2/c1-2-23-36-35(40)33(29-13-7-4-8-14-29)38-24-21-27(22-25-38)26-17-19-30(20-18-26)37-34(39)32-16-10-9-15-31(32)28-11-5-3-6-12-28/h2-21,33H,1,22-25H2,(H,36,40)(H,37,39) |
| InChIKey | VAGQIKKMUPAEKO-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|