C35H38FN5O2 — CID 68870434
N-[4-[4-[1-(diethylamino)-1-oxo-2-phenylpropan-2-yl]piperazin-1-yl]-3-fluorophenyl]-2-pyridin-3-ylbenzamide (PubChem CID 68870434) has the molecular formula C35H38FN5O2 and a molecular weight of 579.72 g/mol. Its IUPAC name is N-[4-[4-[1-(diethylamino)-1-oxo-2-phenylpropan-2-yl]piperazin-1-yl]-3-fluorophenyl]-2-pyridin-3-ylbenzamide.
| Compound Name | N-[4-[4-[1-(diethylamino)-1-oxo-2-phenylpropan-2-yl]piperazin-1-yl]-3-fluorophenyl]-2-pyridin-3-ylbenzamide |
|---|---|
| PubChem CID | 68870434 |
| Molecular Formula | C35H38FN5O2 |
| Molecular Weight | 579.72 g/mol |
| Exact Mass | 579.30 |
| IUPAC Name | N-[4-[4-[1-(diethylamino)-1-oxo-2-phenylpropan-2-yl]piperazin-1-yl]-3-fluorophenyl]-2-pyridin-3-ylbenzamide |
| SMILES | CCN(CC)C(=O)C(C)(c1ccccc1)N1CCN(c2ccc(NC(=O)c3ccccc3-c3cccnc3)cc2F)CC1 |
| InChI | InChI=1S/C35H38FN5O2/c1-4-39(5-2)34(43)35(3,27-13-7-6-8-14-27)41-22-20-40(21-23-41)32-18-17-28(24-31(32)36)38-33(42)30-16-10-9-15-29(30)26-12-11-19-37-25-26/h6-19,24-25H,4-5,20-23H2,1-3H3,(H,38,42) |
| InChIKey | KJKKTYCKBARNTN-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 68.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.72 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|