C28H36FN5O3 — CID 89362254
2-[1-[4-[[(3E)-4-aminooxy-2-methylpenta-1,3-dien-3-yl]carbamoylamino]-2-fluorophenyl]piperidin-4-yl]-N-ethyl-2-phenylacetamide (PubChem CID 89362254) has the molecular formula C28H36FN5O3 and a molecular weight of 509.63 g/mol. Its IUPAC name is 2-[1-[4-[[(3E)-4-aminooxy-2-methylpenta-1,3-dien-3-yl]carbamoylamino]-2-fluorophenyl]piperidin-4-yl]-N-ethyl-2-phenylacetamide.
| Compound Name | 2-[1-[4-[[(3E)-4-aminooxy-2-methylpenta-1,3-dien-3-yl]carbamoylamino]-2-fluorophenyl]piperidin-4-yl]-N-ethyl-2-phenylacetamide |
|---|---|
| PubChem CID | 89362254 |
| Molecular Formula | C28H36FN5O3 |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.28 |
| IUPAC Name | 2-[1-[4-[[(3E)-4-aminooxy-2-methylpenta-1,3-dien-3-yl]carbamoylamino]-2-fluorophenyl]piperidin-4-yl]-N-ethyl-2-phenylacetamide |
| SMILES | C=C(C)/C(NC(=O)Nc1ccc(N2CCC(C(C(=O)NCC)c3ccccc3)CC2)c(F)c1)=C(/C)ON |
| InChI | InChI=1S/C28H36FN5O3/c1-5-31-27(35)25(20-9-7-6-8-10-20)21-13-15-34(16-14-21)24-12-11-22(17-23(24)29)32-28(36)33-26(18(2)3)19(4)37-30/h6-12,17,21,25H,2,5,13-16,30H2,1,3-4H3,(H,31,35)(H2,32,33,36)/b26-19+ |
| InChIKey | ZOFZLLRYBHDFSA-LGUFXXKBSA-N |
| XLogP | 4.78 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|