C19H22FN3O2 — CID 110911319
1-(3-fluoro-4-pyrrolidin-1-ylphenyl)-3-[[2-(hydroxymethyl)phenyl]methyl]urea (PubChem CID 110911319) has the molecular formula C19H22FN3O2 and a molecular weight of 343.40 g/mol. Its IUPAC name is 1-(3-fluoro-4-pyrrolidin-1-ylphenyl)-3-[[2-(hydroxymethyl)phenyl]methyl]urea.
| Compound Name | 1-(3-fluoro-4-pyrrolidin-1-ylphenyl)-3-[[2-(hydroxymethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 110911319 |
| Molecular Formula | C19H22FN3O2 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 1-(3-fluoro-4-pyrrolidin-1-ylphenyl)-3-[[2-(hydroxymethyl)phenyl]methyl]urea |
| SMILES | O=C(NCc1ccccc1CO)Nc1ccc(N2CCCC2)c(F)c1 |
| InChI | InChI=1S/C19H22FN3O2/c20-17-11-16(7-8-18(17)23-9-3-4-10-23)22-19(25)21-12-14-5-1-2-6-15(14)13-24/h1-2,5-8,11,24H,3-4,9-10,12-13H2,(H2,21,22,25) |
| InChIKey | DCEDLFYHXDIDTC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|