C17H24FN3O2 — CID 111926057
1-(3-fluoro-4-pyrrolidin-1-ylphenyl)-3-[1-(hydroxymethyl)cyclopentyl]urea (PubChem CID 111926057) has the molecular formula C17H24FN3O2 and a molecular weight of 321.40 g/mol. Its IUPAC name is 1-(3-fluoro-4-pyrrolidin-1-ylphenyl)-3-[1-(hydroxymethyl)cyclopentyl]urea.
| Compound Name | 1-(3-fluoro-4-pyrrolidin-1-ylphenyl)-3-[1-(hydroxymethyl)cyclopentyl]urea |
|---|---|
| PubChem CID | 111926057 |
| Molecular Formula | C17H24FN3O2 |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 1-(3-fluoro-4-pyrrolidin-1-ylphenyl)-3-[1-(hydroxymethyl)cyclopentyl]urea |
| SMILES | O=C(Nc1ccc(N2CCCC2)c(F)c1)NC1(CO)CCCC1 |
| InChI | InChI=1S/C17H24FN3O2/c18-14-11-13(5-6-15(14)21-9-3-4-10-21)19-16(23)20-17(12-22)7-1-2-8-17/h5-6,11,22H,1-4,7-10,12H2,(H2,19,20,23) |
| InChIKey | GEFLWJYKUNWXJF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|