C16H16FN3O3 — CID 51102571
2-fluoro-5-[[2-(hydroxymethyl)phenyl]methylcarbamoylamino]benzamide (PubChem CID 51102571) has the molecular formula C16H16FN3O3 and a molecular weight of 317.32 g/mol. Its IUPAC name is 2-fluoro-5-[[2-(hydroxymethyl)phenyl]methylcarbamoylamino]benzamide.
| Compound Name | 2-fluoro-5-[[2-(hydroxymethyl)phenyl]methylcarbamoylamino]benzamide |
|---|---|
| PubChem CID | 51102571 |
| Molecular Formula | C16H16FN3O3 |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 2-fluoro-5-[[2-(hydroxymethyl)phenyl]methylcarbamoylamino]benzamide |
| SMILES | NC(=O)c1cc(NC(=O)NCc2ccccc2CO)ccc1F |
| InChI | InChI=1S/C16H16FN3O3/c17-14-6-5-12(7-13(14)15(18)22)20-16(23)19-8-10-3-1-2-4-11(10)9-21/h1-7,21H,8-9H2,(H2,18,22)(H2,19,20,23) |
| InChIKey | FJNPKZRAUQPDBX-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |