C15H16FN3O — CID 62951380
1-[[2-(aminomethyl)phenyl]methyl]-3-(3-fluorophenyl)urea (PubChem CID 62951380) has the molecular formula C15H16FN3O and a molecular weight of 273.31 g/mol. Its IUPAC name is 1-[[2-(aminomethyl)phenyl]methyl]-3-(3-fluorophenyl)urea.
| Compound Name | 1-[[2-(aminomethyl)phenyl]methyl]-3-(3-fluorophenyl)urea |
|---|---|
| PubChem CID | 62951380 |
| Molecular Formula | C15H16FN3O |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 1-[[2-(aminomethyl)phenyl]methyl]-3-(3-fluorophenyl)urea |
| SMILES | NCc1ccccc1CNC(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C15H16FN3O/c16-13-6-3-7-14(8-13)19-15(20)18-10-12-5-2-1-4-11(12)9-17/h1-8H,9-10,17H2,(H2,18,19,20) |
| InChIKey | KPYJEOLZTVMSMF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |