C13H12FN3O3 — CID 47039415
2-fluoro-5-(furan-3-ylmethylcarbamoylamino)benzamide (PubChem CID 47039415) has the molecular formula C13H12FN3O3 and a molecular weight of 277.26 g/mol. Its IUPAC name is 2-fluoro-5-(furan-3-ylmethylcarbamoylamino)benzamide.
| Compound Name | 2-fluoro-5-(furan-3-ylmethylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 47039415 |
| Molecular Formula | C13H12FN3O3 |
| Molecular Weight | 277.26 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 2-fluoro-5-(furan-3-ylmethylcarbamoylamino)benzamide |
| SMILES | NC(=O)c1cc(NC(=O)NCc2ccoc2)ccc1F |
| InChI | InChI=1S/C13H12FN3O3/c14-11-2-1-9(5-10(11)12(15)18)17-13(19)16-6-8-3-4-20-7-8/h1-5,7H,6H2,(H2,15,18)(H2,16,17,19) |
| InChIKey | VJFPTXOTQLSJFY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |