C12H10FNO3 — CID 63204868
2-fluoro-5-(furan-3-ylmethylamino)benzoic acid (PubChem CID 63204868) has the molecular formula C12H10FNO3 and a molecular weight of 235.21 g/mol. Its IUPAC name is 2-fluoro-5-(furan-3-ylmethylamino)benzoic acid.
| Compound Name | 2-fluoro-5-(furan-3-ylmethylamino)benzoic acid |
|---|---|
| PubChem CID | 63204868 |
| Molecular Formula | C12H10FNO3 |
| Molecular Weight | 235.21 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 2-fluoro-5-(furan-3-ylmethylamino)benzoic acid |
| SMILES | O=C(O)c1cc(NCc2ccoc2)ccc1F |
| InChI | InChI=1S/C12H10FNO3/c13-11-2-1-9(5-10(11)12(15)16)14-6-8-3-4-17-7-8/h1-5,7,14H,6H2,(H,15,16) |
| InChIKey | SVCCAYFMUGJDMZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.21 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |