C12H9BrFNO2S — CID 43728012
5-[(4-bromothiophen-2-yl)methylamino]-2-fluorobenzoic acid (PubChem CID 43728012) has the molecular formula C12H9BrFNO2S and a molecular weight of 330.18 g/mol. Its IUPAC name is 5-[(4-bromothiophen-2-yl)methylamino]-2-fluorobenzoic acid.
| Compound Name | 5-[(4-bromothiophen-2-yl)methylamino]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 43728012 |
| Molecular Formula | C12H9BrFNO2S |
| Molecular Weight | 330.18 g/mol |
| Exact Mass | 328.95 |
| IUPAC Name | 5-[(4-bromothiophen-2-yl)methylamino]-2-fluorobenzoic acid |
| SMILES | O=C(O)c1cc(NCc2cc(Br)cs2)ccc1F |
| InChI | InChI=1S/C12H9BrFNO2S/c13-7-3-9(18-6-7)5-15-8-1-2-11(14)10(4-8)12(16)17/h1-4,6,15H,5H2,(H,16,17) |
| InChIKey | KTZUAVREQPCZIH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.18 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |